C19H29N3O4 — CID 96538034
tert-butyl (3R)-3-[[1-(furan-2-carbonyl)piperidin-4-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 96538034) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[1-(furan-2-carbonyl)piperidin-4-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[1-(furan-2-carbonyl)piperidin-4-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 96538034 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl (3R)-3-[[1-(furan-2-carbonyl)piperidin-4-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](NC2CCN(C(=O)c3ccco3)CC2)C1 |
| InChI | InChI=1S/C19H29N3O4/c1-19(2,3)26-18(24)22-11-8-15(13-22)20-14-6-9-21(10-7-14)17(23)16-5-4-12-25-16/h4-5,12,14-15,20H,6-11,13H2,1-3H3/t15-/m1/s1 |
| InChIKey | PHPHFYDGVWQISE-OAHLLOKOSA-N |
| XLogP | 2.48 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |