C15H25ClN2O3 — CID 75365791
tert-butyl 4-(furan-2-ylmethylamino)piperidine-1-carboxylate;hydrochloride (PubChem CID 75365791) has the molecular formula C15H25ClN2O3 and a molecular weight of 316.83 g/mol. Its IUPAC name is tert-butyl 4-(furan-2-ylmethylamino)piperidine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 4-(furan-2-ylmethylamino)piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 75365791 |
| Molecular Formula | C15H25ClN2O3 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | tert-butyl 4-(furan-2-ylmethylamino)piperidine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCc2ccco2)CC1.Cl |
| InChI | InChI=1S/C15H24N2O3.ClH/c1-15(2,3)20-14(18)17-8-6-12(7-9-17)16-11-13-5-4-10-19-13;/h4-5,10,12,16H,6-9,11H2,1-3H3;1H |
| InChIKey | IWAVCAVHZXAOBM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |