C19H31BrN2O2 — CID 143006069
tert-butyl 4-[(3-bromophenyl)methylamino]piperidine-1-carboxylate;ethane (PubChem CID 143006069) has the molecular formula C19H31BrN2O2 and a molecular weight of 399.37 g/mol. Its IUPAC name is tert-butyl 4-[(3-bromophenyl)methylamino]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[(3-bromophenyl)methylamino]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143006069 |
| Molecular Formula | C19H31BrN2O2 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | tert-butyl 4-[(3-bromophenyl)methylamino]piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(NCc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C17H25BrN2O2.C2H6/c1-17(2,3)22-16(21)20-9-7-15(8-10-20)19-12-13-5-4-6-14(18)11-13;1-2/h4-6,11,15,19H,7-10,12H2,1-3H3;1-2H3 |
| InChIKey | CRVCUZLSCDQFTF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |