C17H24BrN3O3 — CID 60601996
tert-butyl 4-[(3-bromophenyl)methylcarbamoyl]piperazine-1-carboxylate (PubChem CID 60601996) has the molecular formula C17H24BrN3O3 and a molecular weight of 398.30 g/mol. Its IUPAC name is tert-butyl 4-[(3-bromophenyl)methylcarbamoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-bromophenyl)methylcarbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 60601996 |
| Molecular Formula | C17H24BrN3O3 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | tert-butyl 4-[(3-bromophenyl)methylcarbamoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)NCc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C17H24BrN3O3/c1-17(2,3)24-16(23)21-9-7-20(8-10-21)15(22)19-12-13-5-4-6-14(18)11-13/h4-6,11H,7-10,12H2,1-3H3,(H,19,22) |
| InChIKey | OETOMDVQLUBHRT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |