C17H25BrN2O2 — CID 53256485
tert-butyl (3R)-3-[(3-bromophenyl)methylamino]piperidine-1-carboxylate (PubChem CID 53256485) has the molecular formula C17H25BrN2O2 and a molecular weight of 369.30 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(3-bromophenyl)methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(3-bromophenyl)methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 53256485 |
| Molecular Formula | C17H25BrN2O2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | tert-butyl (3R)-3-[(3-bromophenyl)methylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](NCc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C17H25BrN2O2/c1-17(2,3)22-16(21)20-9-5-8-15(12-20)19-11-13-6-4-7-14(18)10-13/h4,6-7,10,15,19H,5,8-9,11-12H2,1-3H3/t15-/m1/s1 |
| InChIKey | UDNCJGVTDHTJNA-OAHLLOKOSA-N |
| XLogP | 3.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |