C20H32N2O3 — CID 113361531
tert-butyl 4-[[3-(methoxymethyl)phenyl]methylamino]azepane-1-carboxylate (PubChem CID 113361531) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl 4-[[3-(methoxymethyl)phenyl]methylamino]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(methoxymethyl)phenyl]methylamino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 113361531 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | tert-butyl 4-[[3-(methoxymethyl)phenyl]methylamino]azepane-1-carboxylate |
| SMILES | COCc1cccc(CNC2CCCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C20H32N2O3/c1-20(2,3)25-19(23)22-11-6-9-18(10-12-22)21-14-16-7-5-8-17(13-16)15-24-4/h5,7-8,13,18,21H,6,9-12,14-15H2,1-4H3 |
| InChIKey | KPIDHMMHDGKOBH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |