C16H25N3O4S — CID 113268866
tert-butyl 3-[(3-sulfamoylphenyl)methylamino]pyrrolidine-1-carboxylate (PubChem CID 113268866) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is tert-butyl 3-[(3-sulfamoylphenyl)methylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-sulfamoylphenyl)methylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 113268866 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | tert-butyl 3-[(3-sulfamoylphenyl)methylamino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCc2cccc(S(N)(=O)=O)c2)C1 |
| InChI | InChI=1S/C16H25N3O4S/c1-16(2,3)23-15(20)19-8-7-13(11-19)18-10-12-5-4-6-14(9-12)24(17,21)22/h4-6,9,13,18H,7-8,10-11H2,1-3H3,(H2,17,21,22) |
| InChIKey | JNMBNOVRSRBVEJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |