C19H28N2O2 — CID 103524796
tert-butyl 3-[(4-cyclopropylphenyl)methylamino]pyrrolidine-1-carboxylate (PubChem CID 103524796) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is tert-butyl 3-[(4-cyclopropylphenyl)methylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-cyclopropylphenyl)methylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103524796 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | tert-butyl 3-[(4-cyclopropylphenyl)methylamino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCc2ccc(C3CC3)cc2)C1 |
| InChI | InChI=1S/C19H28N2O2/c1-19(2,3)23-18(22)21-11-10-17(13-21)20-12-14-4-6-15(7-5-14)16-8-9-16/h4-7,16-17,20H,8-13H2,1-3H3 |
| InChIKey | IYANGHIHCYSDHQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |