C18H28N4O2S — CID 169357708
tert-butyl 3-[[4-(carbamothioylamino)phenyl]methylamino]piperidine-1-carboxylate (PubChem CID 169357708) has the molecular formula C18H28N4O2S and a molecular weight of 364.52 g/mol. Its IUPAC name is tert-butyl 3-[[4-(carbamothioylamino)phenyl]methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(carbamothioylamino)phenyl]methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169357708 |
| Molecular Formula | C18H28N4O2S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | tert-butyl 3-[[4-(carbamothioylamino)phenyl]methylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NCc2ccc(NC(N)=S)cc2)C1 |
| InChI | InChI=1S/C18H28N4O2S/c1-18(2,3)24-17(23)22-10-4-5-15(12-22)20-11-13-6-8-14(9-7-13)21-16(19)25/h6-9,15,20H,4-5,10-12H2,1-3H3,(H3,19,21,25) |
| InChIKey | AAIMKCGMHOPVCE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|