C22H26N6O2 — CID 168608193
tert-butyl 3-[[4-(1,2,2-tricyanoethenylamino)phenyl]methylamino]piperidine-1-carboxylate (PubChem CID 168608193) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is tert-butyl 3-[[4-(1,2,2-tricyanoethenylamino)phenyl]methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(1,2,2-tricyanoethenylamino)phenyl]methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168608193 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | tert-butyl 3-[[4-(1,2,2-tricyanoethenylamino)phenyl]methylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NCc2ccc(NC(C#N)=C(C#N)C#N)cc2)C1 |
| InChI | InChI=1S/C22H26N6O2/c1-22(2,3)30-21(29)28-10-4-5-19(15-28)26-14-16-6-8-18(9-7-16)27-20(13-25)17(11-23)12-24/h6-9,19,26-27H,4-5,10,14-15H2,1-3H3 |
| InChIKey | SYARLYYXIGWUDM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|