C17H25N5O2 — CID 169325405
tert-butyl 3-[(4-azidophenyl)methylamino]piperidine-1-carboxylate (PubChem CID 169325405) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is tert-butyl 3-[(4-azidophenyl)methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-azidophenyl)methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169325405 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | tert-butyl 3-[(4-azidophenyl)methylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NCc2ccc(N=[N+]=[N-])cc2)C1 |
| InChI | InChI=1S/C17H25N5O2/c1-17(2,3)24-16(23)22-10-4-5-15(12-22)19-11-13-6-8-14(9-7-13)20-21-18/h6-9,15,19H,4-5,10-12H2,1-3H3 |
| InChIKey | BTJXKFHDVZPONO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|