C16H21N5O3 — CID 118983509
tert-butyl 3-[(4-azidobenzoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 118983509) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is tert-butyl 3-[(4-azidobenzoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-azidobenzoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118983509 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | tert-butyl 3-[(4-azidobenzoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2ccc(N=[N+]=[N-])cc2)C1 |
| InChI | InChI=1S/C16H21N5O3/c1-16(2,3)24-15(23)21-9-8-13(10-21)18-14(22)11-4-6-12(7-5-11)19-20-17/h4-7,13H,8-10H2,1-3H3,(H,18,22) |
| InChIKey | SKTVVQZWYPVUHL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|