C16H21IN2O3 — CID 169298596
tert-butyl (3S)-3-[(4-iodobenzoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 169298596) has the molecular formula C16H21IN2O3 and a molecular weight of 416.26 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(4-iodobenzoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(4-iodobenzoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169298596 |
| Molecular Formula | C16H21IN2O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | tert-butyl (3S)-3-[(4-iodobenzoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](NC(=O)c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C16H21IN2O3/c1-16(2,3)22-15(21)19-9-8-13(10-19)18-14(20)11-4-6-12(17)7-5-11/h4-7,13H,8-10H2,1-3H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | CFBFZOGDSSZVCJ-ZDUSSCGKSA-N |
| XLogP | 3.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|