C19H29N3O4 — CID 171933166
tert-butyl 3-[(3-amino-4-propan-2-yloxybenzoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 171933166) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is tert-butyl 3-[(3-amino-4-propan-2-yloxybenzoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-amino-4-propan-2-yloxybenzoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171933166 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl 3-[(3-amino-4-propan-2-yloxybenzoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)Oc1ccc(C(=O)NC2CCN(C(=O)OC(C)(C)C)C2)cc1N |
| InChI | InChI=1S/C19H29N3O4/c1-12(2)25-16-7-6-13(10-15(16)20)17(23)21-14-8-9-22(11-14)18(24)26-19(3,4)5/h6-7,10,12,14H,8-9,11,20H2,1-5H3,(H,21,23) |
| InChIKey | UCQZMTBEBCICQB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|