About tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate
tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate (PubChem CID 175091768) has the molecular formula C22H32FN3O4
and a molecular weight of 421.51 g/mol. Its IUPAC name is tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate |
| PubChem CID | 175091768 |
| Molecular Formula | C22H32FN3O4 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC1CN(c2ccc(C(=O)NC3CCN(C(=O)OC(C)(C)C)C3)cc2F)CC(C)O1 |
| InChI | InChI=1S/C22H32FN3O4/c1-14-11-26(12-15(2)29-14)19-7-6-16(10-18(19)23)20(27)24-17-8-9-25(13-17)21(28)30-22(3,4)5/h6-7,10,14-15,17H,8-9,11-13H2,1-5H3,(H,24,27) |
| InChIKey | JXNVCNUSAWPTJE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate (CID 175091768) is tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate is CC1CN(c2ccc(C(=O)NC3CCN(C(=O)OC(C)(C)C)C3)cc2F)CC(C)O1.
What is the InChIKey of tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate?
The InChIKey is JXNVCNUSAWPTJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32FN3O4/c1-14-11-26(12-15(2)29-14)19-7-6-16(10-18(19)23)20(27)24-17-8-9-25(13-17)21(28)30-22(3,4)5/h6-7,10,14-15,17H,8-9,11-13H2,1-5H3,(H,24,27).
What are the key properties of tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate?
tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate has a molecular weight of 421.51 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[[4-(2,6-dimethylmorpholin-4-yl)-3-fluorobenzoyl]amino]pyrrolidine-1-carboxylate is sourced from PubChem (CID 175091768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).