C16H22FN3O3 — CID 122598249
tert-butyl (3R)-3-[(4-amino-2-fluorobenzoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 122598249) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-amino-2-fluorobenzoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(4-amino-2-fluorobenzoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 122598249 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | tert-butyl (3R)-3-[(4-amino-2-fluorobenzoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](NC(=O)c2ccc(N)cc2F)C1 |
| InChI | InChI=1S/C16H22FN3O3/c1-16(2,3)23-15(22)20-7-6-11(9-20)19-14(21)12-5-4-10(18)8-13(12)17/h4-5,8,11H,6-7,9,18H2,1-3H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | CDFLJPYHVZDAOM-LLVKDONJSA-N |
| XLogP | 2.15 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|