C17H25FN4O3 — CID 166815279
tert-butyl 3-[(4,5-diamino-2-fluorobenzoyl)amino]piperidine-1-carboxylate (PubChem CID 166815279) has the molecular formula C17H25FN4O3 and a molecular weight of 352.41 g/mol. Its IUPAC name is tert-butyl 3-[(4,5-diamino-2-fluorobenzoyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4,5-diamino-2-fluorobenzoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166815279 |
| Molecular Formula | C17H25FN4O3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | tert-butyl 3-[(4,5-diamino-2-fluorobenzoyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NC(=O)c2cc(N)c(N)cc2F)C1 |
| InChI | InChI=1S/C17H25FN4O3/c1-17(2,3)25-16(24)22-6-4-5-10(9-22)21-15(23)11-7-13(19)14(20)8-12(11)18/h7-8,10H,4-6,9,19-20H2,1-3H3,(H,21,23) |
| InChIKey | TYZVTKYHEZZDDV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|