C17H23FN2O4 — CID 113227118
4-fluoro-3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]amino]benzoic acid (PubChem CID 113227118) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is 4-fluoro-3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]amino]benzoic acid.
| Compound Name | 4-fluoro-3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113227118 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-fluoro-3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]amino]benzoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2cc(C(=O)O)ccc2F)C1 |
| InChI | InChI=1S/C17H23FN2O4/c1-17(2,3)24-16(23)20-8-4-5-12(10-20)19-14-9-11(15(21)22)6-7-13(14)18/h6-7,9,12,19H,4-5,8,10H2,1-3H3,(H,21,22) |
| InChIKey | DFQNBYWVMQHPAS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |