C16H22ClIN2O2 — CID 107632499
tert-butyl 3-(4-chloro-2-iodoanilino)piperidine-1-carboxylate (PubChem CID 107632499) has the molecular formula C16H22ClIN2O2 and a molecular weight of 436.72 g/mol. Its IUPAC name is tert-butyl 3-(4-chloro-2-iodoanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-chloro-2-iodoanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107632499 |
| Molecular Formula | C16H22ClIN2O2 |
| Molecular Weight | 436.72 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | tert-butyl 3-(4-chloro-2-iodoanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2ccc(Cl)cc2I)C1 |
| InChI | InChI=1S/C16H22ClIN2O2/c1-16(2,3)22-15(21)20-8-4-5-12(10-20)19-14-7-6-11(17)9-13(14)18/h6-7,9,12,19H,4-5,8,10H2,1-3H3 |
| InChIKey | ZOAOKKRTDGIJJI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|