C17H24N4O5 — CID 124907561
tert-butyl (3R)-3-(2-carbamoyl-4-nitroanilino)piperidine-1-carboxylate (PubChem CID 124907561) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is tert-butyl (3R)-3-(2-carbamoyl-4-nitroanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(2-carbamoyl-4-nitroanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 124907561 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | tert-butyl (3R)-3-(2-carbamoyl-4-nitroanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Nc2ccc([N+](=O)[O-])cc2C(N)=O)C1 |
| InChI | InChI=1S/C17H24N4O5/c1-17(2,3)26-16(23)20-8-4-5-11(10-20)19-14-7-6-12(21(24)25)9-13(14)15(18)22/h6-7,9,11,19H,4-5,8,10H2,1-3H3,(H2,18,22)/t11-/m1/s1 |
| InChIKey | CDWCWQXKSGOFPF-LLVKDONJSA-N |
| XLogP | 2.51 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|