C19H20F2N4O4 — CID 133325741
2-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-5-nitrobenzamide (PubChem CID 133325741) has the molecular formula C19H20F2N4O4 and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-5-nitrobenzamide.
| Compound Name | 2-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 133325741 |
| Molecular Formula | C19H20F2N4O4 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-5-nitrobenzamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])ccc1NC1CCCN(c2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C19H20F2N4O4/c20-19(21)29-15-6-3-13(4-7-15)24-9-1-2-12(11-24)23-17-8-5-14(25(27)28)10-16(17)18(22)26/h3-8,10,12,19,23H,1-2,9,11H2,(H2,22,26) |
| InChIKey | ZCQUDVWAEMBSIO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|