C17H18FN5O3 — CID 133411822
2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-5-nitropyridine-3-carboxamide (PubChem CID 133411822) has the molecular formula C17H18FN5O3 and a molecular weight of 359.36 g/mol. Its IUPAC name is 2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133411822 |
| Molecular Formula | C17H18FN5O3 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-5-nitropyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cnc1NC1CCCN(c2ccccc2F)C1 |
| InChI | InChI=1S/C17H18FN5O3/c18-14-5-1-2-6-15(14)22-7-3-4-11(10-22)21-17-13(16(19)24)8-12(9-20-17)23(25)26/h1-2,5-6,8-9,11H,3-4,7,10H2,(H2,19,24)(H,20,21) |
| InChIKey | TVLUEPKCLCIFLC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|