C17H19FN4O4S — CID 133411795
2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-5-nitrobenzenesulfonamide (PubChem CID 133411795) has the molecular formula C17H19FN4O4S and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-5-nitrobenzenesulfonamide.
| Compound Name | 2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133411795 |
| Molecular Formula | C17H19FN4O4S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-5-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc([N+](=O)[O-])ccc1NC1CCCN(c2ccccc2F)C1 |
| InChI | InChI=1S/C17H19FN4O4S/c18-14-5-1-2-6-16(14)21-9-3-4-12(11-21)20-15-8-7-13(22(23)24)10-17(15)27(19,25)26/h1-2,5-8,10,12,20H,3-4,9,11H2,(H2,19,25,26) |
| InChIKey | SGFHHXYINQYAIB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|