C19H22FN3O4S — CID 133414052
1-(4-fluoro-2-methylphenyl)-N-(3-methylsulfonyl-2-nitrophenyl)piperidin-3-amine (PubChem CID 133414052) has the molecular formula C19H22FN3O4S and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-N-(3-methylsulfonyl-2-nitrophenyl)piperidin-3-amine.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-N-(3-methylsulfonyl-2-nitrophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 133414052 |
| Molecular Formula | C19H22FN3O4S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-N-(3-methylsulfonyl-2-nitrophenyl)piperidin-3-amine |
| SMILES | Cc1cc(F)ccc1N1CCCC(Nc2cccc(S(C)(=O)=O)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H22FN3O4S/c1-13-11-14(20)8-9-17(13)22-10-4-5-15(12-22)21-16-6-3-7-18(28(2,26)27)19(16)23(24)25/h3,6-9,11,15,21H,4-5,10,12H2,1-2H3 |
| InChIKey | MWAMMHBUDWQVBS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|