C15H17N3O4S2 — CID 133393877
2-[1-(3-methylsulfonyl-2-nitrophenyl)piperidin-3-yl]-1,3-thiazole (PubChem CID 133393877) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[1-(3-methylsulfonyl-2-nitrophenyl)piperidin-3-yl]-1,3-thiazole.
| Compound Name | 2-[1-(3-methylsulfonyl-2-nitrophenyl)piperidin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 133393877 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-[1-(3-methylsulfonyl-2-nitrophenyl)piperidin-3-yl]-1,3-thiazole |
| SMILES | CS(=O)(=O)c1cccc(N2CCCC(c3nccs3)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O4S2/c1-24(21,22)13-6-2-5-12(14(13)18(19)20)17-8-3-4-11(10-17)15-16-7-9-23-15/h2,5-7,9,11H,3-4,8,10H2,1H3 |
| InChIKey | LONASWNQNFRKCK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|