C15H18F3N3O5S — CID 133414224
1-(3-methylsulfonyl-2-nitrophenyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 133414224) has the molecular formula C15H18F3N3O5S and a molecular weight of 409.39 g/mol. Its IUPAC name is 1-(3-methylsulfonyl-2-nitrophenyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | 1-(3-methylsulfonyl-2-nitrophenyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133414224 |
| Molecular Formula | C15H18F3N3O5S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 1-(3-methylsulfonyl-2-nitrophenyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(N2CCCC(C(=O)NCC(F)(F)F)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18F3N3O5S/c1-27(25,26)12-6-2-5-11(13(12)21(23)24)20-7-3-4-10(8-20)14(22)19-9-15(16,17)18/h2,5-6,10H,3-4,7-9H2,1H3,(H,19,22) |
| InChIKey | ZMTWERMCDMERNT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|