C15H17F4N3O4 — CID 133341208
1-(3-fluoro-5-methoxy-2-nitrophenyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 133341208) has the molecular formula C15H17F4N3O4 and a molecular weight of 379.31 g/mol. Its IUPAC name is 1-(3-fluoro-5-methoxy-2-nitrophenyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | 1-(3-fluoro-5-methoxy-2-nitrophenyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133341208 |
| Molecular Formula | C15H17F4N3O4 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-(3-fluoro-5-methoxy-2-nitrophenyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | COc1cc(F)c([N+](=O)[O-])c(N2CCCC(C(=O)NCC(F)(F)F)C2)c1 |
| InChI | InChI=1S/C15H17F4N3O4/c1-26-10-5-11(16)13(22(24)25)12(6-10)21-4-2-3-9(7-21)14(23)20-8-15(17,18)19/h5-6,9H,2-4,7-8H2,1H3,(H,20,23) |
| InChIKey | KOVBCQGXVUAKHI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|