C20H24FN3O5 — CID 133337409
N-(3,5-dimethoxyphenyl)-1-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-amine (PubChem CID 133337409) has the molecular formula C20H24FN3O5 and a molecular weight of 405.43 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-1-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 133337409 |
| Molecular Formula | C20H24FN3O5 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-amine |
| SMILES | COc1cc(NC2CCN(c3cc(OC)cc(F)c3[N+](=O)[O-])CC2)cc(OC)c1 |
| InChI | InChI=1S/C20H24FN3O5/c1-27-15-8-14(9-16(10-15)28-2)22-13-4-6-23(7-5-13)19-12-17(29-3)11-18(21)20(19)24(25)26/h8-13,22H,4-7H2,1-3H3 |
| InChIKey | CGPWUGYPCVHHRU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|