C18H21N3O2S — CID 167963148
3-[4-(3,5-dimethoxyanilino)piperidin-1-yl]thiophene-2-carbonitrile (PubChem CID 167963148) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-[4-(3,5-dimethoxyanilino)piperidin-1-yl]thiophene-2-carbonitrile.
| Compound Name | 3-[4-(3,5-dimethoxyanilino)piperidin-1-yl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 167963148 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-[4-(3,5-dimethoxyanilino)piperidin-1-yl]thiophene-2-carbonitrile |
| SMILES | COc1cc(NC2CCN(c3ccsc3C#N)CC2)cc(OC)c1 |
| InChI | InChI=1S/C18H21N3O2S/c1-22-15-9-14(10-16(11-15)23-2)20-13-3-6-21(7-4-13)17-5-8-24-18(17)12-19/h5,8-11,13,20H,3-4,6-7H2,1-2H3 |
| InChIKey | IJRVJERUOVBJKD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |