C19H25N3O2 — CID 122144100
N-(3,5-dimethoxyphenyl)-1-(4-methyl-2-pyridinyl)piperidin-4-amine (PubChem CID 122144100) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-(4-methyl-2-pyridinyl)piperidin-4-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-1-(4-methyl-2-pyridinyl)piperidin-4-amine |
|---|---|
| PubChem CID | 122144100 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-(4-methyl-2-pyridinyl)piperidin-4-amine |
| SMILES | COc1cc(NC2CCN(c3cc(C)ccn3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C19H25N3O2/c1-14-4-7-20-19(10-14)22-8-5-15(6-9-22)21-16-11-17(23-2)13-18(12-16)24-3/h4,7,10-13,15,21H,5-6,8-9H2,1-3H3 |
| InChIKey | GLILFGYNAOMCBX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |