C20H22ClN3O2 — CID 133337445
2-chloro-4-[4-(3,5-dimethoxyanilino)piperidin-1-yl]benzonitrile (PubChem CID 133337445) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 2-chloro-4-[4-(3,5-dimethoxyanilino)piperidin-1-yl]benzonitrile.
| Compound Name | 2-chloro-4-[4-(3,5-dimethoxyanilino)piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 133337445 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-chloro-4-[4-(3,5-dimethoxyanilino)piperidin-1-yl]benzonitrile |
| SMILES | COc1cc(NC2CCN(c3ccc(C#N)c(Cl)c3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-25-18-9-16(10-19(12-18)26-2)23-15-5-7-24(8-6-15)17-4-3-14(13-22)20(21)11-17/h3-4,9-12,15,23H,5-8H2,1-2H3 |
| InChIKey | UZDHVKOFTAMKHQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |