C15H16N4OS — CID 81297131
4-methoxy-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzonitrile (PubChem CID 81297131) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 4-methoxy-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzonitrile.
| Compound Name | 4-methoxy-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 81297131 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-methoxy-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzonitrile |
| SMILES | COc1ccc(C#N)c(N2CCN(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C15H16N4OS/c1-20-13-3-2-12(11-16)14(10-13)18-5-7-19(8-6-18)15-17-4-9-21-15/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | OEZCWXHSSYZVCY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |