C13H17N3O — CID 81297511
2-(1,4-diazepan-1-yl)-4-methoxybenzonitrile (PubChem CID 81297511) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-4-methoxybenzonitrile.
| Compound Name | 2-(1,4-diazepan-1-yl)-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 81297511 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)c(N2CCCNCC2)c1 |
| InChI | InChI=1S/C13H17N3O/c1-17-12-4-3-11(10-14)13(9-12)16-7-2-5-15-6-8-16/h3-4,9,15H,2,5-8H2,1H3 |
| InChIKey | JAJAWRUGGBMNHZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |