C15H16N4O4S — CID 36597297
methyl 5-nitro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzoate (PubChem CID 36597297) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is methyl 5-nitro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzoate.
| Compound Name | methyl 5-nitro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 36597297 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | methyl 5-nitro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H16N4O4S/c1-23-14(20)12-10-11(19(21)22)2-3-13(12)17-5-7-18(8-6-17)15-16-4-9-24-15/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | WQUGFVZBNAZBIA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|