C19H18F3N3O7S — CID 36514027
methyl 5-nitro-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]benzoate (PubChem CID 36514027) has the molecular formula C19H18F3N3O7S and a molecular weight of 489.43 g/mol. Its IUPAC name is methyl 5-nitro-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]benzoate.
| Compound Name | methyl 5-nitro-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 36514027 |
| Molecular Formula | C19H18F3N3O7S |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | methyl 5-nitro-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]benzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1N1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H18F3N3O7S/c1-31-18(26)16-12-13(25(27)28)2-7-17(16)23-8-10-24(11-9-23)33(29,30)15-5-3-14(4-6-15)32-19(20,21)22/h2-7,12H,8-11H2,1H3 |
| InChIKey | SMPLJUQCUQXZKW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|