C20H18F3N3O6 — CID 35777368
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate (PubChem CID 35777368) has the molecular formula C20H18F3N3O6 and a molecular weight of 453.37 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 35777368 |
| Molecular Formula | C20H18F3N3O6 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 5-nitro-2-pyrrolidin-1-ylbenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1N1CCCC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F3N3O6/c21-20(22,23)32-15-6-3-13(4-7-15)24-18(27)12-31-19(28)16-11-14(26(29)30)5-8-17(16)25-9-1-2-10-25/h3-8,11H,1-2,9-10,12H2,(H,24,27) |
| InChIKey | KJSINSJWBMYCQU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|