C17H14F3N3O6 — CID 7752228
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(methylamino)-5-nitrobenzoate (PubChem CID 7752228) has the molecular formula C17H14F3N3O6 and a molecular weight of 413.31 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(methylamino)-5-nitrobenzoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(methylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7752228 |
| Molecular Formula | C17H14F3N3O6 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(methylamino)-5-nitrobenzoate |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3N3O6/c1-21-14-7-4-11(23(26)27)8-13(14)16(25)28-9-15(24)22-10-2-5-12(6-3-10)29-17(18,19)20/h2-8,21H,9H2,1H3,(H,22,24) |
| InChIKey | UBHUXSPUWUTZQZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|