C20H21N3O7 — CID 7603827
[2-(4-acetylanilino)-2-oxoethyl] 2-(2-methoxyethylamino)-5-nitrobenzoate (PubChem CID 7603827) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] 2-(2-methoxyethylamino)-5-nitrobenzoate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] 2-(2-methoxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7603827 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] 2-(2-methoxyethylamino)-5-nitrobenzoate |
| SMILES | COCCNc1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C20H21N3O7/c1-13(24)14-3-5-15(6-4-14)22-19(25)12-30-20(26)17-11-16(23(27)28)7-8-18(17)21-9-10-29-2/h3-8,11,21H,9-10,12H2,1-2H3,(H,22,25) |
| InChIKey | JNULEEYIJJCKGX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|