C10H13N3O4 — CID 2960673
2-(2-methoxyethylamino)-5-nitrobenzamide (PubChem CID 2960673) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-5-nitrobenzamide.
| Compound Name | 2-(2-methoxyethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 2960673 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-(2-methoxyethylamino)-5-nitrobenzamide |
| SMILES | COCCNc1ccc([N+](=O)[O-])cc1C(N)=O |
| InChI | InChI=1S/C10H13N3O4/c1-17-5-4-12-9-3-2-7(13(15)16)6-8(9)10(11)14/h2-3,6,12H,4-5H2,1H3,(H2,11,14) |
| InChIKey | NPKTYZVTLXQWGQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|