About [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate
[2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate (PubChem CID 7990288) has the molecular formula C15H12FN3O5
and a molecular weight of 333.28 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate.
Molecular Properties
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate |
| PubChem CID | 7990288 |
| Molecular Formula | C15H12FN3O5 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate |
| SMILES | Nc1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H12FN3O5/c16-9-1-3-10(4-2-9)18-14(20)8-24-15(21)12-7-11(19(22)23)5-6-13(12)17/h1-7H,8,17H2,(H,18,20) |
| InChIKey | SWNODKRNSPMVKD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate?
The IUPAC name of [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate (CID 7990288) is [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate.
What is the SMILES notation for [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate?
The canonical SMILES for [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate is Nc1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)Nc1ccc(F)cc1.
What is the InChIKey of [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate?
The InChIKey is SWNODKRNSPMVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN3O5/c16-9-1-3-10(4-2-9)18-14(20)8-24-15(21)12-7-11(19(22)23)5-6-13(12)17/h1-7H,8,17H2,(H,18,20).
What are the key properties of [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate?
[2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate has a molecular weight of 333.28 g/mol, XLogP of 2.11, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluoroanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate is sourced from PubChem (CID 7990288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).