C17H17N3O7 — CID 40631105
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate (PubChem CID 40631105) has the molecular formula C17H17N3O7 and a molecular weight of 375.34 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate |
|---|---|
| PubChem CID | 40631105 |
| Molecular Formula | C17H17N3O7 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-amino-5-nitrobenzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cc([N+](=O)[O-])ccc2N)cc(OC)c1 |
| InChI | InChI=1S/C17H17N3O7/c1-25-12-5-10(6-13(8-12)26-2)19-16(21)9-27-17(22)14-7-11(20(23)24)3-4-15(14)18/h3-8H,9,18H2,1-2H3,(H,19,21) |
| InChIKey | UFYMZBSMKTVVDS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|