C15H8F5N3O5 — CID 7990348
[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-amino-5-nitrobenzoate (PubChem CID 7990348) has the molecular formula C15H8F5N3O5 and a molecular weight of 405.24 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-amino-5-nitrobenzoate.
| Compound Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-amino-5-nitrobenzoate |
|---|---|
| PubChem CID | 7990348 |
| Molecular Formula | C15H8F5N3O5 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-amino-5-nitrobenzoate |
| SMILES | Nc1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H8F5N3O5/c16-9-10(17)12(19)14(13(20)11(9)18)22-8(24)4-28-15(25)6-3-5(23(26)27)1-2-7(6)21/h1-3H,4,21H2,(H,22,24) |
| InChIKey | RSTZRBBSGNXTFU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|