C17H15F2N3O5 — CID 7990112
[2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl] 2-amino-5-nitrobenzoate (PubChem CID 7990112) has the molecular formula C17H15F2N3O5 and a molecular weight of 379.32 g/mol. Its IUPAC name is [2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl] 2-amino-5-nitrobenzoate.
| Compound Name | [2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl] 2-amino-5-nitrobenzoate |
|---|---|
| PubChem CID | 7990112 |
| Molecular Formula | C17H15F2N3O5 |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl] 2-amino-5-nitrobenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1cc([N+](=O)[O-])ccc1N)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H15F2N3O5/c1-9(12-4-2-10(18)6-14(12)19)21-16(23)8-27-17(24)13-7-11(22(25)26)3-5-15(13)20/h2-7,9H,8,20H2,1H3,(H,21,23)/t9-/m1/s1 |
| InChIKey | IIGOOWYRQKEMGT-SECBINFHSA-N |
| XLogP | 2.49 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|