C20H17FN4O3S2 — CID 34005334
[2-(2-fluorophenyl)sulfanyl-5-nitrophenyl]-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 34005334) has the molecular formula C20H17FN4O3S2 and a molecular weight of 444.51 g/mol. Its IUPAC name is [2-(2-fluorophenyl)sulfanyl-5-nitrophenyl]-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | [2-(2-fluorophenyl)sulfanyl-5-nitrophenyl]-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 34005334 |
| Molecular Formula | C20H17FN4O3S2 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | [2-(2-fluorophenyl)sulfanyl-5-nitrophenyl]-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1Sc1ccccc1F)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C20H17FN4O3S2/c21-16-3-1-2-4-18(16)30-17-6-5-14(25(27)28)13-15(17)19(26)23-8-10-24(11-9-23)20-22-7-12-29-20/h1-7,12-13H,8-11H2 |
| InChIKey | WMSVFXMLFVGQFI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|