C20H18N4O6S2 — CID 43040230
[4-[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]phenyl] 3-nitrobenzenesulfonate (PubChem CID 43040230) has the molecular formula C20H18N4O6S2 and a molecular weight of 474.52 g/mol. Its IUPAC name is [4-[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [4-[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 43040230 |
| Molecular Formula | C20H18N4O6S2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | [4-[4-(1,3-thiazol-2-yl)piperazine-1-carbonyl]phenyl] 3-nitrobenzenesulfonate |
| SMILES | O=C(c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C20H18N4O6S2/c25-19(22-9-11-23(12-10-22)20-21-8-13-31-20)15-4-6-17(7-5-15)30-32(28,29)18-3-1-2-16(14-18)24(26)27/h1-8,13-14H,9-12H2 |
| InChIKey | NNXICRXIDNAMCW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 122.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|