C19H14N2O8S2 — CID 26704916
methyl 3-[[4-(3-nitrophenyl)sulfonyloxybenzoyl]amino]thiophene-2-carboxylate (PubChem CID 26704916) has the molecular formula C19H14N2O8S2 and a molecular weight of 462.46 g/mol. Its IUPAC name is methyl 3-[[4-(3-nitrophenyl)sulfonyloxybenzoyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[4-(3-nitrophenyl)sulfonyloxybenzoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 26704916 |
| Molecular Formula | C19H14N2O8S2 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | methyl 3-[[4-(3-nitrophenyl)sulfonyloxybenzoyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H14N2O8S2/c1-28-19(23)17-16(9-10-30-17)20-18(22)12-5-7-14(8-6-12)29-31(26,27)15-4-2-3-13(11-15)21(24)25/h2-11H,1H3,(H,20,22) |
| InChIKey | DYHQDGYLTUSOAI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|