C20H18N4O6S — CID 55496864
[4-[[6-(dimethylamino)-3-pyridinyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate (PubChem CID 55496864) has the molecular formula C20H18N4O6S and a molecular weight of 442.45 g/mol. Its IUPAC name is [4-[[6-(dimethylamino)-3-pyridinyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [4-[[6-(dimethylamino)-3-pyridinyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 55496864 |
| Molecular Formula | C20H18N4O6S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | [4-[[6-(dimethylamino)-3-pyridinyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc(OS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)cn1 |
| InChI | InChI=1S/C20H18N4O6S/c1-23(2)19-11-8-15(13-21-19)22-20(25)14-6-9-17(10-7-14)30-31(28,29)18-5-3-4-16(12-18)24(26)27/h3-13H,1-2H3,(H,22,25) |
| InChIKey | UDMQKAIXCKPTNQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|