C21H16F2N2O6S — CID 38221906
[4-[(2,4-difluorophenyl)methyl-methylcarbamoyl]phenyl] 3-nitrobenzenesulfonate (PubChem CID 38221906) has the molecular formula C21H16F2N2O6S and a molecular weight of 462.43 g/mol. Its IUPAC name is [4-[(2,4-difluorophenyl)methyl-methylcarbamoyl]phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [4-[(2,4-difluorophenyl)methyl-methylcarbamoyl]phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 38221906 |
| Molecular Formula | C21H16F2N2O6S |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | [4-[(2,4-difluorophenyl)methyl-methylcarbamoyl]phenyl] 3-nitrobenzenesulfonate |
| SMILES | CN(Cc1ccc(F)cc1F)C(=O)c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H16F2N2O6S/c1-24(13-15-5-8-16(22)11-20(15)23)21(26)14-6-9-18(10-7-14)31-32(29,30)19-4-2-3-17(12-19)25(27)28/h2-12H,13H2,1H3 |
| InChIKey | RSIWLFZJIGHWOW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|