C23H23N3O5S — CID 27886844
N-[(2,4-dimethylphenyl)methyl]-N-methyl-4-[(3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 27886844) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-N-methyl-4-[(3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-N-methyl-4-[(3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 27886844 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-N-methyl-4-[(3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(CN(C)C(=O)c2ccc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H23N3O5S/c1-16-7-8-19(17(2)13-16)15-25(3)23(27)18-9-11-20(12-10-18)24-32(30,31)22-6-4-5-21(14-22)26(28)29/h4-14,24H,15H2,1-3H3 |
| InChIKey | YKLKVKFIJPXHMI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|