C21H21N3O6S2 — CID 22202762
3-nitro-N-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]benzenesulfonamide (PubChem CID 22202762) has the molecular formula C21H21N3O6S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-nitro-N-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]benzenesulfonamide.
| Compound Name | 3-nitro-N-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22202762 |
| Molecular Formula | C21H21N3O6S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 3-nitro-N-[4-[(2,4,6-trimethylphenyl)sulfamoyl]phenyl]benzenesulfonamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2ccc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H21N3O6S2/c1-14-11-15(2)21(16(3)12-14)23-31(27,28)19-9-7-17(8-10-19)22-32(29,30)20-6-4-5-18(13-20)24(25)26/h4-13,22-23H,1-3H3 |
| InChIKey | FXPNLTMYRSQTNI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|